C8H12BrN3O3S — CID 136956238
5-bromo-4-(3-methylsulfonylpropylamino)-1H-pyrimidin-6-one (PubChem CID 136956238) has the molecular formula C8H12BrN3O3S and a molecular weight of 310.17 g/mol. Its IUPAC name is 5-bromo-4-(3-methylsulfonylpropylamino)-1H-pyrimidin-6-one.
| Compound Name | 5-bromo-4-(3-methylsulfonylpropylamino)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136956238 |
| Molecular Formula | C8H12BrN3O3S |
| Molecular Weight | 310.17 g/mol |
| Exact Mass | 308.98 |
| IUPAC Name | 5-bromo-4-(3-methylsulfonylpropylamino)-1H-pyrimidin-6-one |
| SMILES | CS(=O)(=O)CCCNc1nc[nH]c(=O)c1Br |
| InChI | InChI=1S/C8H12BrN3O3S/c1-16(14,15)4-2-3-10-7-6(9)8(13)12-5-11-7/h5H,2-4H2,1H3,(H2,10,11,12,13) |
| InChIKey | RGJMFFPCUXRKIP-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 91.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.17 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|