C8H11N3O3 — CID 136955986
methyl 2-[(2-methyl-6-oxo-1H-pyrimidin-4-yl)amino]acetate (PubChem CID 136955986) has the molecular formula C8H11N3O3 and a molecular weight of 197.19 g/mol. Its IUPAC name is methyl 2-[(2-methyl-6-oxo-1H-pyrimidin-4-yl)amino]acetate.
| Compound Name | methyl 2-[(2-methyl-6-oxo-1H-pyrimidin-4-yl)amino]acetate |
|---|---|
| PubChem CID | 136955986 |
| Molecular Formula | C8H11N3O3 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.08 |
| IUPAC Name | methyl 2-[(2-methyl-6-oxo-1H-pyrimidin-4-yl)amino]acetate |
| SMILES | COC(=O)CNc1cc(=O)[nH]c(C)n1 |
| InChI | InChI=1S/C8H11N3O3/c1-5-10-6(3-7(12)11-5)9-4-8(13)14-2/h3H,4H2,1-2H3,(H2,9,10,11,12) |
| InChIKey | IAVYJNNJXNGXFU-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |