C7H9N3O3 — CID 136955988
methyl 2-[(6-oxo-1H-pyrimidin-4-yl)amino]acetate (PubChem CID 136955988) has the molecular formula C7H9N3O3 and a molecular weight of 183.17 g/mol. Its IUPAC name is methyl 2-[(6-oxo-1H-pyrimidin-4-yl)amino]acetate.
| Compound Name | methyl 2-[(6-oxo-1H-pyrimidin-4-yl)amino]acetate |
|---|---|
| PubChem CID | 136955988 |
| Molecular Formula | C7H9N3O3 |
| Molecular Weight | 183.17 g/mol |
| Exact Mass | 183.06 |
| IUPAC Name | methyl 2-[(6-oxo-1H-pyrimidin-4-yl)amino]acetate |
| SMILES | COC(=O)CNc1cc(=O)[nH]cn1 |
| InChI | InChI=1S/C7H9N3O3/c1-13-7(12)3-8-5-2-6(11)10-4-9-5/h2,4H,3H2,1H3,(H2,8,9,10,11) |
| InChIKey | KJNICEQXDGEISN-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.17 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |