C12H18N4O — CID 136956156
4-[(1-cyclopropylpyrrolidin-3-yl)methylamino]-1H-pyrimidin-6-one (PubChem CID 136956156) has the molecular formula C12H18N4O and a molecular weight of 234.30 g/mol. Its IUPAC name is 4-[(1-cyclopropylpyrrolidin-3-yl)methylamino]-1H-pyrimidin-6-one.
| Compound Name | 4-[(1-cyclopropylpyrrolidin-3-yl)methylamino]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136956156 |
| Molecular Formula | C12H18N4O |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | 4-[(1-cyclopropylpyrrolidin-3-yl)methylamino]-1H-pyrimidin-6-one |
| SMILES | O=c1cc(NCC2CCN(C3CC3)C2)nc[nH]1 |
| InChI | InChI=1S/C12H18N4O/c17-12-5-11(14-8-15-12)13-6-9-3-4-16(7-9)10-1-2-10/h5,8-10H,1-4,6-7H2,(H2,13,14,15,17) |
| InChIKey | FXSNQIHXRBNUDY-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |