C15H24N4O — CID 62939854
3-[(1-cyclopropylpyrrolidin-3-yl)methylamino]-1-propan-2-ylpyrazin-2-one (PubChem CID 62939854) has the molecular formula C15H24N4O and a molecular weight of 276.38 g/mol. Its IUPAC name is 3-[(1-cyclopropylpyrrolidin-3-yl)methylamino]-1-propan-2-ylpyrazin-2-one.
| Compound Name | 3-[(1-cyclopropylpyrrolidin-3-yl)methylamino]-1-propan-2-ylpyrazin-2-one |
|---|---|
| PubChem CID | 62939854 |
| Molecular Formula | C15H24N4O |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.20 |
| IUPAC Name | 3-[(1-cyclopropylpyrrolidin-3-yl)methylamino]-1-propan-2-ylpyrazin-2-one |
| SMILES | CC(C)n1ccnc(NCC2CCN(C3CC3)C2)c1=O |
| InChI | InChI=1S/C15H24N4O/c1-11(2)19-8-6-16-14(15(19)20)17-9-12-5-7-18(10-12)13-3-4-13/h6,8,11-13H,3-5,7,9-10H2,1-2H3,(H,16,17) |
| InChIKey | YTLIYHNSKUJTOX-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |