C8H11IN4O2 — CID 136956163
4-[(5-iodo-6-oxo-1H-pyrimidin-4-yl)amino]butanamide (PubChem CID 136956163) has the molecular formula C8H11IN4O2 and a molecular weight of 322.11 g/mol. Its IUPAC name is 4-[(5-iodo-6-oxo-1H-pyrimidin-4-yl)amino]butanamide.
| Compound Name | 4-[(5-iodo-6-oxo-1H-pyrimidin-4-yl)amino]butanamide |
|---|---|
| PubChem CID | 136956163 |
| Molecular Formula | C8H11IN4O2 |
| Molecular Weight | 322.11 g/mol |
| Exact Mass | 321.99 |
| IUPAC Name | 4-[(5-iodo-6-oxo-1H-pyrimidin-4-yl)amino]butanamide |
| SMILES | NC(=O)CCCNc1nc[nH]c(=O)c1I |
| InChI | InChI=1S/C8H11IN4O2/c9-6-7(12-4-13-8(6)15)11-3-1-2-5(10)14/h4H,1-3H2,(H2,10,14)(H2,11,12,13,15) |
| InChIKey | PHWFSIILWUXVHN-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.11 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|