C8H9BrF3N3O — CID 136957050
5-bromo-4-(4,4,4-trifluorobutylamino)-1H-pyrimidin-6-one (PubChem CID 136957050) has the molecular formula C8H9BrF3N3O and a molecular weight of 300.08 g/mol. Its IUPAC name is 5-bromo-4-(4,4,4-trifluorobutylamino)-1H-pyrimidin-6-one.
| Compound Name | 5-bromo-4-(4,4,4-trifluorobutylamino)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136957050 |
| Molecular Formula | C8H9BrF3N3O |
| Molecular Weight | 300.08 g/mol |
| Exact Mass | 298.99 |
| IUPAC Name | 5-bromo-4-(4,4,4-trifluorobutylamino)-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]cnc(NCCCC(F)(F)F)c1Br |
| InChI | InChI=1S/C8H9BrF3N3O/c9-5-6(14-4-15-7(5)16)13-3-1-2-8(10,11)12/h4H,1-3H2,(H2,13,14,15,16) |
| InChIKey | RGIAVEWKDFYYTP-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.08 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|