C9H13BrN4O3 — CID 136957154
2-[(5-bromo-6-oxo-1H-pyrimidin-4-yl)amino]-N-(2-methoxyethyl)acetamide (PubChem CID 136957154) has the molecular formula C9H13BrN4O3 and a molecular weight of 305.13 g/mol. Its IUPAC name is 2-[(5-bromo-6-oxo-1H-pyrimidin-4-yl)amino]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[(5-bromo-6-oxo-1H-pyrimidin-4-yl)amino]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 136957154 |
| Molecular Formula | C9H13BrN4O3 |
| Molecular Weight | 305.13 g/mol |
| Exact Mass | 304.02 |
| IUPAC Name | 2-[(5-bromo-6-oxo-1H-pyrimidin-4-yl)amino]-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)CNc1nc[nH]c(=O)c1Br |
| InChI | InChI=1S/C9H13BrN4O3/c1-17-3-2-11-6(15)4-12-8-7(10)9(16)14-5-13-8/h5H,2-4H2,1H3,(H,11,15)(H2,12,13,14,16) |
| InChIKey | KAEWHJSNUOZSBV-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 96.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.13 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|