C8H12IN3O2S — CID 136957212
5-iodo-4-(2-methylsulfinylpropylamino)-1H-pyrimidin-6-one (PubChem CID 136957212) has the molecular formula C8H12IN3O2S and a molecular weight of 341.17 g/mol. Its IUPAC name is 5-iodo-4-(2-methylsulfinylpropylamino)-1H-pyrimidin-6-one.
| Compound Name | 5-iodo-4-(2-methylsulfinylpropylamino)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136957212 |
| Molecular Formula | C8H12IN3O2S |
| Molecular Weight | 341.17 g/mol |
| Exact Mass | 340.97 |
| IUPAC Name | 5-iodo-4-(2-methylsulfinylpropylamino)-1H-pyrimidin-6-one |
| SMILES | CC(CNc1nc[nH]c(=O)c1I)S(C)=O |
| InChI | InChI=1S/C8H12IN3O2S/c1-5(15(2)14)3-10-7-6(9)8(13)12-4-11-7/h4-5H,3H2,1-2H3,(H2,10,11,12,13) |
| InChIKey | YXHFWGMZMOKBCS-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.17 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|