C9H10IN3OS — CID 136842331
5-iodo-4-(2-prop-2-ynylsulfanylethylamino)-1H-pyrimidin-6-one (PubChem CID 136842331) has the molecular formula C9H10IN3OS and a molecular weight of 335.17 g/mol. Its IUPAC name is 5-iodo-4-(2-prop-2-ynylsulfanylethylamino)-1H-pyrimidin-6-one.
| Compound Name | 5-iodo-4-(2-prop-2-ynylsulfanylethylamino)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136842331 |
| Molecular Formula | C9H10IN3OS |
| Molecular Weight | 335.17 g/mol |
| Exact Mass | 334.96 |
| IUPAC Name | 5-iodo-4-(2-prop-2-ynylsulfanylethylamino)-1H-pyrimidin-6-one |
| SMILES | C#CCSCCNc1nc[nH]c(=O)c1I |
| InChI | InChI=1S/C9H10IN3OS/c1-2-4-15-5-3-11-8-7(10)9(14)13-6-12-8/h1,6H,3-5H2,(H2,11,12,13,14) |
| InChIKey | FUCQPGSXWXFYHI-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.17 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|