C9H11N3OS — CID 136842334
4-(2-prop-2-ynylsulfanylethylamino)-1H-pyrimidin-6-one (PubChem CID 136842334) has the molecular formula C9H11N3OS and a molecular weight of 209.27 g/mol. Its IUPAC name is 4-(2-prop-2-ynylsulfanylethylamino)-1H-pyrimidin-6-one.
| Compound Name | 4-(2-prop-2-ynylsulfanylethylamino)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136842334 |
| Molecular Formula | C9H11N3OS |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.06 |
| IUPAC Name | 4-(2-prop-2-ynylsulfanylethylamino)-1H-pyrimidin-6-one |
| SMILES | C#CCSCCNc1cc(=O)[nH]cn1 |
| InChI | InChI=1S/C9H11N3OS/c1-2-4-14-5-3-10-8-6-9(13)12-7-11-8/h1,6-7H,3-5H2,(H2,10,11,12,13) |
| InChIKey | ZHSLAFPQVNNWBV-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|