C9H12N4OS — CID 136842327
5-amino-4-(2-prop-2-ynylsulfanylethylamino)-1H-pyrimidin-6-one (PubChem CID 136842327) has the molecular formula C9H12N4OS and a molecular weight of 224.29 g/mol. Its IUPAC name is 5-amino-4-(2-prop-2-ynylsulfanylethylamino)-1H-pyrimidin-6-one.
| Compound Name | 5-amino-4-(2-prop-2-ynylsulfanylethylamino)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136842327 |
| Molecular Formula | C9H12N4OS |
| Molecular Weight | 224.29 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | 5-amino-4-(2-prop-2-ynylsulfanylethylamino)-1H-pyrimidin-6-one |
| SMILES | C#CCSCCNc1nc[nH]c(=O)c1N |
| InChI | InChI=1S/C9H12N4OS/c1-2-4-15-5-3-11-8-7(10)9(14)13-6-12-8/h1,6H,3-5,10H2,(H2,11,12,13,14) |
| InChIKey | GWNAYGMEABLUPN-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.29 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|