C10H14N4O4 — CID 136958423
2-[[2-[(2-ethyl-6-oxo-1H-pyrimidin-4-yl)amino]acetyl]amino]acetic acid (PubChem CID 136958423) has the molecular formula C10H14N4O4 and a molecular weight of 254.25 g/mol. Its IUPAC name is 2-[[2-[(2-ethyl-6-oxo-1H-pyrimidin-4-yl)amino]acetyl]amino]acetic acid.
| Compound Name | 2-[[2-[(2-ethyl-6-oxo-1H-pyrimidin-4-yl)amino]acetyl]amino]acetic acid |
|---|---|
| PubChem CID | 136958423 |
| Molecular Formula | C10H14N4O4 |
| Molecular Weight | 254.25 g/mol |
| Exact Mass | 254.10 |
| IUPAC Name | 2-[[2-[(2-ethyl-6-oxo-1H-pyrimidin-4-yl)amino]acetyl]amino]acetic acid |
| SMILES | CCc1nc(NCC(=O)NCC(=O)O)cc(=O)[nH]1 |
| InChI | InChI=1S/C10H14N4O4/c1-2-6-13-7(3-8(15)14-6)11-4-9(16)12-5-10(17)18/h3H,2,4-5H2,1H3,(H,12,16)(H,17,18)(H2,11,13,14,15) |
| InChIKey | QWQBYPWUNDSEHX-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 124.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.25 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |