C6H8N4O3 — CID 136958443
2-[(5-amino-6-oxo-1H-pyrimidin-4-yl)amino]acetic acid (PubChem CID 136958443) has the molecular formula C6H8N4O3 and a molecular weight of 184.16 g/mol. Its IUPAC name is 2-[(5-amino-6-oxo-1H-pyrimidin-4-yl)amino]acetic acid.
| Compound Name | 2-[(5-amino-6-oxo-1H-pyrimidin-4-yl)amino]acetic acid |
|---|---|
| PubChem CID | 136958443 |
| Molecular Formula | C6H8N4O3 |
| Molecular Weight | 184.16 g/mol |
| Exact Mass | 184.06 |
| IUPAC Name | 2-[(5-amino-6-oxo-1H-pyrimidin-4-yl)amino]acetic acid |
| SMILES | Nc1c(NCC(=O)O)nc[nH]c1=O |
| InChI | InChI=1S/C6H8N4O3/c7-4-5(8-1-3(11)12)9-2-10-6(4)13/h2H,1,7H2,(H,11,12)(H2,8,9,10,13) |
| InChIKey | OOSACYPUBWJGJB-UHFFFAOYSA-N |
| XLogP | -1.15 |
| TPSA | 121.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.16 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |