C13H12ClN3O3 — CID 136958542
2-chloro-5-[(2-ethyl-6-oxo-1H-pyrimidin-4-yl)amino]benzoic acid (PubChem CID 136958542) has the molecular formula C13H12ClN3O3 and a molecular weight of 293.71 g/mol. Its IUPAC name is 2-chloro-5-[(2-ethyl-6-oxo-1H-pyrimidin-4-yl)amino]benzoic acid.
| Compound Name | 2-chloro-5-[(2-ethyl-6-oxo-1H-pyrimidin-4-yl)amino]benzoic acid |
|---|---|
| PubChem CID | 136958542 |
| Molecular Formula | C13H12ClN3O3 |
| Molecular Weight | 293.71 g/mol |
| Exact Mass | 293.06 |
| IUPAC Name | 2-chloro-5-[(2-ethyl-6-oxo-1H-pyrimidin-4-yl)amino]benzoic acid |
| SMILES | CCc1nc(Nc2ccc(Cl)c(C(=O)O)c2)cc(=O)[nH]1 |
| InChI | InChI=1S/C13H12ClN3O3/c1-2-10-16-11(6-12(18)17-10)15-7-3-4-9(14)8(5-7)13(19)20/h3-6H,2H2,1H3,(H,19,20)(H2,15,16,17,18) |
| InChIKey | MAWFZOXVKQPXHQ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.71 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |