C11H10ClN3O2S — CID 65272830
2-chloro-5-[(3-ethyl-1,2,4-thiadiazol-5-yl)amino]benzoic acid (PubChem CID 65272830) has the molecular formula C11H10ClN3O2S and a molecular weight of 283.74 g/mol. Its IUPAC name is 2-chloro-5-[(3-ethyl-1,2,4-thiadiazol-5-yl)amino]benzoic acid.
| Compound Name | 2-chloro-5-[(3-ethyl-1,2,4-thiadiazol-5-yl)amino]benzoic acid |
|---|---|
| PubChem CID | 65272830 |
| Molecular Formula | C11H10ClN3O2S |
| Molecular Weight | 283.74 g/mol |
| Exact Mass | 283.02 |
| IUPAC Name | 2-chloro-5-[(3-ethyl-1,2,4-thiadiazol-5-yl)amino]benzoic acid |
| SMILES | CCc1nsc(Nc2ccc(Cl)c(C(=O)O)c2)n1 |
| InChI | InChI=1S/C11H10ClN3O2S/c1-2-9-14-11(18-15-9)13-6-3-4-8(12)7(5-6)10(16)17/h3-5H,2H2,1H3,(H,16,17)(H,13,14,15) |
| InChIKey | XUOGKBGHASDNJP-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.74 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |