C12H13N3O3S — CID 107208965
4-[(3-ethyl-1,2,4-thiadiazol-5-yl)amino]-2-methoxybenzoic acid (PubChem CID 107208965) has the molecular formula C12H13N3O3S and a molecular weight of 279.32 g/mol. Its IUPAC name is 4-[(3-ethyl-1,2,4-thiadiazol-5-yl)amino]-2-methoxybenzoic acid.
| Compound Name | 4-[(3-ethyl-1,2,4-thiadiazol-5-yl)amino]-2-methoxybenzoic acid |
|---|---|
| PubChem CID | 107208965 |
| Molecular Formula | C12H13N3O3S |
| Molecular Weight | 279.32 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | 4-[(3-ethyl-1,2,4-thiadiazol-5-yl)amino]-2-methoxybenzoic acid |
| SMILES | CCc1nsc(Nc2ccc(C(=O)O)c(OC)c2)n1 |
| InChI | InChI=1S/C12H13N3O3S/c1-3-10-14-12(19-15-10)13-7-4-5-8(11(16)17)9(6-7)18-2/h4-6H,3H2,1-2H3,(H,16,17)(H,13,14,15) |
| InChIKey | OSHFAWINEODXNI-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.32 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |