C13H14ClN3O2S — CID 65272769
5-[(3-tert-butyl-1,2,4-thiadiazol-5-yl)amino]-2-chlorobenzoic acid (PubChem CID 65272769) has the molecular formula C13H14ClN3O2S and a molecular weight of 311.79 g/mol. Its IUPAC name is 5-[(3-tert-butyl-1,2,4-thiadiazol-5-yl)amino]-2-chlorobenzoic acid.
| Compound Name | 5-[(3-tert-butyl-1,2,4-thiadiazol-5-yl)amino]-2-chlorobenzoic acid |
|---|---|
| PubChem CID | 65272769 |
| Molecular Formula | C13H14ClN3O2S |
| Molecular Weight | 311.79 g/mol |
| Exact Mass | 311.05 |
| IUPAC Name | 5-[(3-tert-butyl-1,2,4-thiadiazol-5-yl)amino]-2-chlorobenzoic acid |
| SMILES | CC(C)(C)c1nsc(Nc2ccc(Cl)c(C(=O)O)c2)n1 |
| InChI | InChI=1S/C13H14ClN3O2S/c1-13(2,3)11-16-12(20-17-11)15-7-4-5-9(14)8(6-7)10(18)19/h4-6H,1-3H3,(H,18,19)(H,15,16,17) |
| InChIKey | BAXOZEXYBCJRPJ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.79 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |