C10H15N3O5 — CID 136958759
4-methoxy-2-[(5-methoxy-6-oxo-1H-pyrimidin-4-yl)amino]butanoic acid (PubChem CID 136958759) has the molecular formula C10H15N3O5 and a molecular weight of 257.25 g/mol. Its IUPAC name is 4-methoxy-2-[(5-methoxy-6-oxo-1H-pyrimidin-4-yl)amino]butanoic acid.
| Compound Name | 4-methoxy-2-[(5-methoxy-6-oxo-1H-pyrimidin-4-yl)amino]butanoic acid |
|---|---|
| PubChem CID | 136958759 |
| Molecular Formula | C10H15N3O5 |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | 4-methoxy-2-[(5-methoxy-6-oxo-1H-pyrimidin-4-yl)amino]butanoic acid |
| SMILES | COCCC(Nc1nc[nH]c(=O)c1OC)C(=O)O |
| InChI | InChI=1S/C10H15N3O5/c1-17-4-3-6(10(15)16)13-8-7(18-2)9(14)12-5-11-8/h5-6H,3-4H2,1-2H3,(H,15,16)(H2,11,12,13,14) |
| InChIKey | XWVUVDULOPKWRH-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 113.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |