C11H17N3O4 — CID 136958668
methyl 2-[(5-methoxy-6-oxo-1H-pyrimidin-4-yl)amino]-3-methylbutanoate (PubChem CID 136958668) has the molecular formula C11H17N3O4 and a molecular weight of 255.27 g/mol. Its IUPAC name is methyl 2-[(5-methoxy-6-oxo-1H-pyrimidin-4-yl)amino]-3-methylbutanoate.
| Compound Name | methyl 2-[(5-methoxy-6-oxo-1H-pyrimidin-4-yl)amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 136958668 |
| Molecular Formula | C11H17N3O4 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.12 |
| IUPAC Name | methyl 2-[(5-methoxy-6-oxo-1H-pyrimidin-4-yl)amino]-3-methylbutanoate |
| SMILES | COC(=O)C(Nc1nc[nH]c(=O)c1OC)C(C)C |
| InChI | InChI=1S/C11H17N3O4/c1-6(2)7(11(16)18-4)14-9-8(17-3)10(15)13-5-12-9/h5-7H,1-4H3,(H2,12,13,14,15) |
| InChIKey | NBQNXQOOZBHKIL-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 93.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |