C10H14IN3O3 — CID 136956435
methyl 2-[(5-iodo-6-oxo-1H-pyrimidin-4-yl)amino]-3-methylbutanoate (PubChem CID 136956435) has the molecular formula C10H14IN3O3 and a molecular weight of 351.14 g/mol. Its IUPAC name is methyl 2-[(5-iodo-6-oxo-1H-pyrimidin-4-yl)amino]-3-methylbutanoate.
| Compound Name | methyl 2-[(5-iodo-6-oxo-1H-pyrimidin-4-yl)amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 136956435 |
| Molecular Formula | C10H14IN3O3 |
| Molecular Weight | 351.14 g/mol |
| Exact Mass | 351.01 |
| IUPAC Name | methyl 2-[(5-iodo-6-oxo-1H-pyrimidin-4-yl)amino]-3-methylbutanoate |
| SMILES | COC(=O)C(Nc1nc[nH]c(=O)c1I)C(C)C |
| InChI | InChI=1S/C10H14IN3O3/c1-5(2)7(10(16)17-3)14-8-6(11)9(15)13-4-12-8/h4-5,7H,1-3H3,(H2,12,13,14,15) |
| InChIKey | BWBDBVZGLHQPRK-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.14 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|