C10H16N4O3 — CID 136958666
methyl 2-[(5-amino-6-oxo-1H-pyrimidin-4-yl)amino]-3-methylbutanoate (PubChem CID 136958666) has the molecular formula C10H16N4O3 and a molecular weight of 240.26 g/mol. Its IUPAC name is methyl 2-[(5-amino-6-oxo-1H-pyrimidin-4-yl)amino]-3-methylbutanoate.
| Compound Name | methyl 2-[(5-amino-6-oxo-1H-pyrimidin-4-yl)amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 136958666 |
| Molecular Formula | C10H16N4O3 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | methyl 2-[(5-amino-6-oxo-1H-pyrimidin-4-yl)amino]-3-methylbutanoate |
| SMILES | COC(=O)C(Nc1nc[nH]c(=O)c1N)C(C)C |
| InChI | InChI=1S/C10H16N4O3/c1-5(2)7(10(16)17-3)14-8-6(11)9(15)13-4-12-8/h4-5,7H,11H2,1-3H3,(H2,12,13,14,15) |
| InChIKey | STFHLTSMKFMEDI-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 110.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |