C8H9N3O5 — CID 136959396
2-[(6-oxo-1H-pyrimidin-4-yl)amino]butanedioic acid (PubChem CID 136959396) has the molecular formula C8H9N3O5 and a molecular weight of 227.18 g/mol. Its IUPAC name is 2-[(6-oxo-1H-pyrimidin-4-yl)amino]butanedioic acid.
| Compound Name | 2-[(6-oxo-1H-pyrimidin-4-yl)amino]butanedioic acid |
|---|---|
| PubChem CID | 136959396 |
| Molecular Formula | C8H9N3O5 |
| Molecular Weight | 227.18 g/mol |
| Exact Mass | 227.05 |
| IUPAC Name | 2-[(6-oxo-1H-pyrimidin-4-yl)amino]butanedioic acid |
| SMILES | O=C(O)CC(Nc1cc(=O)[nH]cn1)C(=O)O |
| InChI | InChI=1S/C8H9N3O5/c12-6-2-5(9-3-10-6)11-4(8(15)16)1-7(13)14/h2-4H,1H2,(H,13,14)(H,15,16)(H2,9,10,11,12) |
| InChIKey | WZAFDISBXFRHTQ-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 132.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.18 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |