C9H13N3O — CID 136977021
4-(pent-4-en-2-ylamino)-1H-pyrimidin-6-one (PubChem CID 136977021) has the molecular formula C9H13N3O and a molecular weight of 179.22 g/mol. Its IUPAC name is 4-(pent-4-en-2-ylamino)-1H-pyrimidin-6-one.
| Compound Name | 4-(pent-4-en-2-ylamino)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136977021 |
| Molecular Formula | C9H13N3O |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.11 |
| IUPAC Name | 4-(pent-4-en-2-ylamino)-1H-pyrimidin-6-one |
| SMILES | C=CCC(C)Nc1cc(=O)[nH]cn1 |
| InChI | InChI=1S/C9H13N3O/c1-3-4-7(2)12-8-5-9(13)11-6-10-8/h3,5-7H,1,4H2,2H3,(H2,10,11,12,13) |
| InChIKey | SZYLCXDUIJWGMM-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|