C9H11N7 — CID 136961394
1-methyl-4-(pyridin-4-yldiazenyl)pyrazole-3,5-diamine (PubChem CID 136961394) has the molecular formula C9H11N7 and a molecular weight of 217.24 g/mol. Its IUPAC name is 1-methyl-4-(pyridin-4-yldiazenyl)pyrazole-3,5-diamine.
| Compound Name | 1-methyl-4-(pyridin-4-yldiazenyl)pyrazole-3,5-diamine |
|---|---|
| PubChem CID | 136961394 |
| Molecular Formula | C9H11N7 |
| Molecular Weight | 217.24 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | 1-methyl-4-(pyridin-4-yldiazenyl)pyrazole-3,5-diamine |
| SMILES | Cn1nc(N)c(/N=N/c2ccncc2)c1N |
| InChI | InChI=1S/C9H11N7/c1-16-9(11)7(8(10)15-16)14-13-6-2-4-12-5-3-6/h2-5H,11H2,1H3,(H2,10,15)/b14-13+ |
| InChIKey | HUHDSOITAVSODF-BUHFOSPRSA-N |
| XLogP | 1.39 |
| TPSA | 107.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.24 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|