C34H34N3OS2+ — CID 136961972
(2Z,5E)-3-ethyl-2-[(3-ethyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-5-[[4-(4-methylphenyl)-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl]methylidene]-1,3-thiazolidin-4-one (PubChem CID 136961972) has the molecular formula C34H34N3OS2+ and a molecular weight of 564.80 g/mol. Its IUPAC name is (2Z,5E)-3-ethyl-2-[(3-ethyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-5-[[4-(4-methylphenyl)-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl]methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (2Z,5E)-3-ethyl-2-[(3-ethyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-5-[[4-(4-methylphenyl)-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl]methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 136961972 |
| Molecular Formula | C34H34N3OS2+ |
| Molecular Weight | 564.80 g/mol |
| Exact Mass | 564.21 |
| IUPAC Name | (2Z,5E)-3-ethyl-2-[(3-ethyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-5-[[4-(4-methylphenyl)-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl]methylidene]-1,3-thiazolidin-4-one |
| SMILES | CCn1c(=O)/c(=C\c2ccc3c(c2)C2CCCC2N3c2ccc(C)cc2)s/c1=C\c1sc2ccccc2[n+]1CC |
| InChI | InChI=1S/C34H34N3OS2/c1-4-35-29-10-6-7-12-30(29)39-32(35)21-33-36(5-2)34(38)31(40-33)20-23-15-18-28-26(19-23)25-9-8-11-27(25)37(28)24-16-13-22(3)14-17-24/h6-7,10,12-21,25,27H,4-5,8-9,11H2,1-3H3/q+1/b31-20+ |
| InChIKey | JGWUGUWVIHPMAX-AJBULDERSA-N |
| XLogP | 6.21 |
| TPSA | 29.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.80 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|