C10H15FN2O2 — CID 136963827
5-fluoro-2-(2-methoxybutan-2-yl)-4-methyl-1H-pyrimidin-6-one (PubChem CID 136963827) has the molecular formula C10H15FN2O2 and a molecular weight of 214.24 g/mol. Its IUPAC name is 5-fluoro-2-(2-methoxybutan-2-yl)-4-methyl-1H-pyrimidin-6-one.
| Compound Name | 5-fluoro-2-(2-methoxybutan-2-yl)-4-methyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136963827 |
| Molecular Formula | C10H15FN2O2 |
| Molecular Weight | 214.24 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | 5-fluoro-2-(2-methoxybutan-2-yl)-4-methyl-1H-pyrimidin-6-one |
| SMILES | CCC(C)(OC)c1nc(C)c(F)c(=O)[nH]1 |
| InChI | InChI=1S/C10H15FN2O2/c1-5-10(3,15-4)9-12-6(2)7(11)8(14)13-9/h5H2,1-4H3,(H,12,13,14) |
| InChIKey | OLBZFWXTLFHDND-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.24 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |