C11H17FN2O2 — CID 136963829
5-fluoro-2-(3-methoxypentan-3-yl)-4-methyl-1H-pyrimidin-6-one (PubChem CID 136963829) has the molecular formula C11H17FN2O2 and a molecular weight of 228.27 g/mol. Its IUPAC name is 5-fluoro-2-(3-methoxypentan-3-yl)-4-methyl-1H-pyrimidin-6-one.
| Compound Name | 5-fluoro-2-(3-methoxypentan-3-yl)-4-methyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136963829 |
| Molecular Formula | C11H17FN2O2 |
| Molecular Weight | 228.27 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | 5-fluoro-2-(3-methoxypentan-3-yl)-4-methyl-1H-pyrimidin-6-one |
| SMILES | CCC(CC)(OC)c1nc(C)c(F)c(=O)[nH]1 |
| InChI | InChI=1S/C11H17FN2O2/c1-5-11(6-2,16-4)10-13-7(3)8(12)9(15)14-10/h5-6H2,1-4H3,(H,13,14,15) |
| InChIKey | WFOPIQRMZQNSHB-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.27 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |