C12H17FN2O2 — CID 136963830
2-(1-ethoxycyclopentyl)-5-fluoro-4-methyl-1H-pyrimidin-6-one (PubChem CID 136963830) has the molecular formula C12H17FN2O2 and a molecular weight of 240.28 g/mol. Its IUPAC name is 2-(1-ethoxycyclopentyl)-5-fluoro-4-methyl-1H-pyrimidin-6-one.
| Compound Name | 2-(1-ethoxycyclopentyl)-5-fluoro-4-methyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136963830 |
| Molecular Formula | C12H17FN2O2 |
| Molecular Weight | 240.28 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | 2-(1-ethoxycyclopentyl)-5-fluoro-4-methyl-1H-pyrimidin-6-one |
| SMILES | CCOC1(c2nc(C)c(F)c(=O)[nH]2)CCCC1 |
| InChI | InChI=1S/C12H17FN2O2/c1-3-17-12(6-4-5-7-12)11-14-8(2)9(13)10(16)15-11/h3-7H2,1-2H3,(H,14,15,16) |
| InChIKey | FPDJPARSNXHQRV-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.28 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |