C29H35FN6O5 — CID 136965085
3-(2,4-dihydroxy-5-propan-2-ylphenyl)-4-[4-[[4-[3-(5-fluoro-2,6-dihydro-1,3-oxazin-3-yl)propanoyl]piperazin-1-yl]methyl]phenyl]-1H-1,2,4-triazol-5-one (PubChem CID 136965085) has the molecular formula C29H35FN6O5 and a molecular weight of 566.63 g/mol. Its IUPAC name is 3-(2,4-dihydroxy-5-propan-2-ylphenyl)-4-[4-[[4-[3-(5-fluoro-2,6-dihydro-1,3-oxazin-3-yl)propanoyl]piperazin-1-yl]methyl]phenyl]-1H-1,2,4-triazol-5-one.
| Compound Name | 3-(2,4-dihydroxy-5-propan-2-ylphenyl)-4-[4-[[4-[3-(5-fluoro-2,6-dihydro-1,3-oxazin-3-yl)propanoyl]piperazin-1-yl]methyl]phenyl]-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 136965085 |
| Molecular Formula | C29H35FN6O5 |
| Molecular Weight | 566.63 g/mol |
| Exact Mass | 566.27 |
| IUPAC Name | 3-(2,4-dihydroxy-5-propan-2-ylphenyl)-4-[4-[[4-[3-(5-fluoro-2,6-dihydro-1,3-oxazin-3-yl)propanoyl]piperazin-1-yl]methyl]phenyl]-1H-1,2,4-triazol-5-one |
| SMILES | CC(C)c1cc(-c2n[nH]c(=O)n2-c2ccc(CN3CCN(C(=O)CCN4C=C(F)COC4)CC3)cc2)c(O)cc1O |
| InChI | InChI=1S/C29H35FN6O5/c1-19(2)23-13-24(26(38)14-25(23)37)28-31-32-29(40)36(28)22-5-3-20(4-6-22)15-33-9-11-35(12-10-33)27(39)7-8-34-16-21(30)17-41-18-34/h3-6,13-14,16,19,37-38H,7-12,15,17-18H2,1-2H3,(H,32,40) |
| InChIKey | JIUAZILUFWWJKU-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 127.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.63 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |