C31H45N5O3S — CID 142379746
(Z)-but-2-ene;3-(2,4-dihydroxy-5-propan-2-ylphenyl)-4-[4-[[4-(3-methyl-3-sulfanylbutyl)piperazin-1-yl]methyl]phenyl]-1H-1,2,4-triazol-5-one (PubChem CID 142379746) has the molecular formula C31H45N5O3S and a molecular weight of 567.80 g/mol. Its IUPAC name is (Z)-but-2-ene;3-(2,4-dihydroxy-5-propan-2-ylphenyl)-4-[4-[[4-(3-methyl-3-sulfanylbutyl)piperazin-1-yl]methyl]phenyl]-1H-1,2,4-triazol-5-one.
| Compound Name | (Z)-but-2-ene;3-(2,4-dihydroxy-5-propan-2-ylphenyl)-4-[4-[[4-(3-methyl-3-sulfanylbutyl)piperazin-1-yl]methyl]phenyl]-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 142379746 |
| Molecular Formula | C31H45N5O3S |
| Molecular Weight | 567.80 g/mol |
| Exact Mass | 567.32 |
| IUPAC Name | (Z)-but-2-ene;3-(2,4-dihydroxy-5-propan-2-ylphenyl)-4-[4-[[4-(3-methyl-3-sulfanylbutyl)piperazin-1-yl]methyl]phenyl]-1H-1,2,4-triazol-5-one |
| SMILES | C/C=C\C.CC(C)c1cc(-c2n[nH]c(=O)n2-c2ccc(CN3CCN(CCC(C)(C)S)CC3)cc2)c(O)cc1O |
| InChI | InChI=1S/C27H37N5O3S.C4H8/c1-18(2)21-15-22(24(34)16-23(21)33)25-28-29-26(35)32(25)20-7-5-19(6-8-20)17-31-13-11-30(12-14-31)10-9-27(3,4)36;1-3-4-2/h5-8,15-16,18,33-34,36H,9-14,17H2,1-4H3,(H,29,35);3-4H,1-2H3/b;4-3- |
| InChIKey | ZFZWKKMBJNCYEE-QGAMPUOQSA-N |
| XLogP | 5.56 |
| TPSA | 97.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.80 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|