C11H9N3O3S — CID 136965903
3-(4-hydroxyanilino)-6-sulfanylidene-1H-pyridazine-5-carboxylic acid (PubChem CID 136965903) has the molecular formula C11H9N3O3S and a molecular weight of 263.28 g/mol. Its IUPAC name is 3-(4-hydroxyanilino)-6-sulfanylidene-1H-pyridazine-5-carboxylic acid.
| Compound Name | 3-(4-hydroxyanilino)-6-sulfanylidene-1H-pyridazine-5-carboxylic acid |
|---|---|
| PubChem CID | 136965903 |
| Molecular Formula | C11H9N3O3S |
| Molecular Weight | 263.28 g/mol |
| Exact Mass | 263.04 |
| IUPAC Name | 3-(4-hydroxyanilino)-6-sulfanylidene-1H-pyridazine-5-carboxylic acid |
| SMILES | O=C(O)c1cc(Nc2ccc(O)cc2)n[nH]c1=S |
| InChI | InChI=1S/C11H9N3O3S/c15-7-3-1-6(2-4-7)12-9-5-8(11(16)17)10(18)14-13-9/h1-5,15H,(H,12,13)(H,14,18)(H,16,17) |
| InChIKey | XOPPYLYNYWHKBH-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 98.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.28 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|