C12H11N3O2S — CID 117103054
3-(4-methylanilino)-6-sulfanylidene-1H-pyridazine-5-carboxylic acid (PubChem CID 117103054) has the molecular formula C12H11N3O2S and a molecular weight of 261.31 g/mol. Its IUPAC name is 3-(4-methylanilino)-6-sulfanylidene-1H-pyridazine-5-carboxylic acid.
| Compound Name | 3-(4-methylanilino)-6-sulfanylidene-1H-pyridazine-5-carboxylic acid |
|---|---|
| PubChem CID | 117103054 |
| Molecular Formula | C12H11N3O2S |
| Molecular Weight | 261.31 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | 3-(4-methylanilino)-6-sulfanylidene-1H-pyridazine-5-carboxylic acid |
| SMILES | Cc1ccc(Nc2cc(C(=O)O)c(=S)[nH]n2)cc1 |
| InChI | InChI=1S/C12H11N3O2S/c1-7-2-4-8(5-3-7)13-10-6-9(12(16)17)11(18)15-14-10/h2-6H,1H3,(H,13,14)(H,15,18)(H,16,17) |
| InChIKey | MACWNTJYHLPCOO-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.31 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|