C16H13F2N3 — CID 141340129
5-(2,6-difluorophenyl)-N-(4-methylphenyl)-1H-pyrazol-3-amine (PubChem CID 141340129) has the molecular formula C16H13F2N3 and a molecular weight of 285.30 g/mol. Its IUPAC name is 5-(2,6-difluorophenyl)-N-(4-methylphenyl)-1H-pyrazol-3-amine.
| Compound Name | 5-(2,6-difluorophenyl)-N-(4-methylphenyl)-1H-pyrazol-3-amine |
|---|---|
| PubChem CID | 141340129 |
| Molecular Formula | C16H13F2N3 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | 5-(2,6-difluorophenyl)-N-(4-methylphenyl)-1H-pyrazol-3-amine |
| SMILES | Cc1ccc(Nc2cc(-c3c(F)cccc3F)[nH]n2)cc1 |
| InChI | InChI=1S/C16H13F2N3/c1-10-5-7-11(8-6-10)19-15-9-14(20-21-15)16-12(17)3-2-4-13(16)18/h2-9H,1H3,(H2,19,20,21) |
| InChIKey | UKXXEZBURNVZTM-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |