C11H6ClFN2O3 — CID 136967064
2-(5-chloro-2-fluorophenyl)-6-oxo-1H-pyrimidine-4-carboxylic acid (PubChem CID 136967064) has the molecular formula C11H6ClFN2O3 and a molecular weight of 268.63 g/mol. Its IUPAC name is 2-(5-chloro-2-fluorophenyl)-6-oxo-1H-pyrimidine-4-carboxylic acid.
| Compound Name | 2-(5-chloro-2-fluorophenyl)-6-oxo-1H-pyrimidine-4-carboxylic acid |
|---|---|
| PubChem CID | 136967064 |
| Molecular Formula | C11H6ClFN2O3 |
| Molecular Weight | 268.63 g/mol |
| Exact Mass | 268.01 |
| IUPAC Name | 2-(5-chloro-2-fluorophenyl)-6-oxo-1H-pyrimidine-4-carboxylic acid |
| SMILES | O=C(O)c1cc(=O)[nH]c(-c2cc(Cl)ccc2F)n1 |
| InChI | InChI=1S/C11H6ClFN2O3/c12-5-1-2-7(13)6(3-5)10-14-8(11(17)18)4-9(16)15-10/h1-4H,(H,17,18)(H,14,15,16) |
| InChIKey | OJPGJVAPTPLNNO-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 83.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.63 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |