C10H12F3N3O2 — CID 136967823
2-(2,2,2-trifluoroethoxymethyl)-5,6,7,8-tetrahydro-3H-pyrido[3,4-d]pyrimidin-4-one (PubChem CID 136967823) has the molecular formula C10H12F3N3O2 and a molecular weight of 263.22 g/mol. Its IUPAC name is 2-(2,2,2-trifluoroethoxymethyl)-5,6,7,8-tetrahydro-3H-pyrido[3,4-d]pyrimidin-4-one.
| Compound Name | 2-(2,2,2-trifluoroethoxymethyl)-5,6,7,8-tetrahydro-3H-pyrido[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 136967823 |
| Molecular Formula | C10H12F3N3O2 |
| Molecular Weight | 263.22 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | 2-(2,2,2-trifluoroethoxymethyl)-5,6,7,8-tetrahydro-3H-pyrido[3,4-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(COCC(F)(F)F)nc2c1CCNC2 |
| InChI | InChI=1S/C10H12F3N3O2/c11-10(12,13)5-18-4-8-15-7-3-14-2-1-6(7)9(17)16-8/h14H,1-5H2,(H,15,16,17) |
| InChIKey | CTIJHQZKIGXXCK-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.22 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |