C12H21N3O2S — CID 136968113
2-[3-(tert-butylamino)-2-hydroxypropyl]sulfanyl-4-methyl-1H-pyrimidin-6-one (PubChem CID 136968113) has the molecular formula C12H21N3O2S and a molecular weight of 271.39 g/mol. Its IUPAC name is 2-[3-(tert-butylamino)-2-hydroxypropyl]sulfanyl-4-methyl-1H-pyrimidin-6-one.
| Compound Name | 2-[3-(tert-butylamino)-2-hydroxypropyl]sulfanyl-4-methyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136968113 |
| Molecular Formula | C12H21N3O2S |
| Molecular Weight | 271.39 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | 2-[3-(tert-butylamino)-2-hydroxypropyl]sulfanyl-4-methyl-1H-pyrimidin-6-one |
| SMILES | Cc1cc(=O)[nH]c(SCC(O)CNC(C)(C)C)n1 |
| InChI | InChI=1S/C12H21N3O2S/c1-8-5-10(17)15-11(14-8)18-7-9(16)6-13-12(2,3)4/h5,9,13,16H,6-7H2,1-4H3,(H,14,15,17) |
| InChIKey | OFYBEHUNHLSALU-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.39 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |