C15H19N3O6S — CID 136969004
(3aR,5S,6S,7R,7aR)-2-methylimino-5-[(1S)-1-(4-nitrophenoxy)ethyl]-1,3a,5,6,7,7a-hexahydropyrano[3,2-d][1,3]thiazole-6,7-diol (PubChem CID 136969004) has the molecular formula C15H19N3O6S and a molecular weight of 369.40 g/mol. Its IUPAC name is (3aR,5S,6S,7R,7aR)-2-methylimino-5-[(1S)-1-(4-nitrophenoxy)ethyl]-1,3a,5,6,7,7a-hexahydropyrano[3,2-d][1,3]thiazole-6,7-diol.
| Compound Name | (3aR,5S,6S,7R,7aR)-2-methylimino-5-[(1S)-1-(4-nitrophenoxy)ethyl]-1,3a,5,6,7,7a-hexahydropyrano[3,2-d][1,3]thiazole-6,7-diol |
|---|---|
| PubChem CID | 136969004 |
| Molecular Formula | C15H19N3O6S |
| Molecular Weight | 369.40 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | (3aR,5S,6S,7R,7aR)-2-methylimino-5-[(1S)-1-(4-nitrophenoxy)ethyl]-1,3a,5,6,7,7a-hexahydropyrano[3,2-d][1,3]thiazole-6,7-diol |
| SMILES | C/N=C1/N[C@@H]2[C@@H](O)[C@H](O)[C@@H]([C@H](C)Oc3ccc([N+](=O)[O-])cc3)O[C@@H]2S1 |
| InChI | InChI=1S/C15H19N3O6S/c1-7(23-9-5-3-8(4-6-9)18(21)22)13-12(20)11(19)10-14(24-13)25-15(16-2)17-10/h3-7,10-14,19-20H,1-2H3,(H,16,17)/t7-,10+,11+,12-,13+,14+/m0/s1 |
| InChIKey | ZXALTOPRNQQXGL-LEBAEOPKSA-N |
| XLogP | 0.50 |
| TPSA | 126.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.40 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|