C11H8BrCl2N3O — CID 136970901
5-bromo-4-(2,6-dichloro-3-methylanilino)-1H-pyrimidin-6-one (PubChem CID 136970901) has the molecular formula C11H8BrCl2N3O and a molecular weight of 349.02 g/mol. Its IUPAC name is 5-bromo-4-(2,6-dichloro-3-methylanilino)-1H-pyrimidin-6-one.
| Compound Name | 5-bromo-4-(2,6-dichloro-3-methylanilino)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136970901 |
| Molecular Formula | C11H8BrCl2N3O |
| Molecular Weight | 349.02 g/mol |
| Exact Mass | 346.92 |
| IUPAC Name | 5-bromo-4-(2,6-dichloro-3-methylanilino)-1H-pyrimidin-6-one |
| SMILES | Cc1ccc(Cl)c(Nc2nc[nH]c(=O)c2Br)c1Cl |
| InChI | InChI=1S/C11H8BrCl2N3O/c1-5-2-3-6(13)9(8(5)14)17-10-7(12)11(18)16-4-15-10/h2-4H,1H3,(H2,15,16,17,18) |
| InChIKey | UKGRPEONJGCSRH-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.02 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |