C11H11Cl2N3 — CID 106555957
N-(2,6-dichloro-3-methylphenyl)-5-methyl-1H-imidazol-2-amine (PubChem CID 106555957) has the molecular formula C11H11Cl2N3 and a molecular weight of 256.14 g/mol. Its IUPAC name is N-(2,6-dichloro-3-methylphenyl)-5-methyl-1H-imidazol-2-amine.
| Compound Name | N-(2,6-dichloro-3-methylphenyl)-5-methyl-1H-imidazol-2-amine |
|---|---|
| PubChem CID | 106555957 |
| Molecular Formula | C11H11Cl2N3 |
| Molecular Weight | 256.14 g/mol |
| Exact Mass | 255.03 |
| IUPAC Name | N-(2,6-dichloro-3-methylphenyl)-5-methyl-1H-imidazol-2-amine |
| SMILES | Cc1cnc(Nc2c(Cl)ccc(C)c2Cl)[nH]1 |
| InChI | InChI=1S/C11H11Cl2N3/c1-6-3-4-8(12)10(9(6)13)16-11-14-5-7(2)15-11/h3-5H,1-2H3,(H2,14,15,16) |
| InChIKey | AHNFEFYFRMGTPQ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.14 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |