C16H24BrN3O — CID 136970931
5-bromo-4-(dicyclohexylamino)-1H-pyrimidin-6-one (PubChem CID 136970931) has the molecular formula C16H24BrN3O and a molecular weight of 354.29 g/mol. Its IUPAC name is 5-bromo-4-(dicyclohexylamino)-1H-pyrimidin-6-one.
| Compound Name | 5-bromo-4-(dicyclohexylamino)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136970931 |
| Molecular Formula | C16H24BrN3O |
| Molecular Weight | 354.29 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | 5-bromo-4-(dicyclohexylamino)-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]cnc(N(C2CCCCC2)C2CCCCC2)c1Br |
| InChI | InChI=1S/C16H24BrN3O/c17-14-15(18-11-19-16(14)21)20(12-7-3-1-4-8-12)13-9-5-2-6-10-13/h11-13H,1-10H2,(H,18,19,21) |
| InChIKey | QHFCWRBIHAHVKW-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.29 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |