C10H12ClN5O — CID 136971007
5-chloro-4-[methyl-[(1-methylpyrazol-4-yl)methyl]amino]-1H-pyrimidin-6-one (PubChem CID 136971007) has the molecular formula C10H12ClN5O and a molecular weight of 253.69 g/mol. Its IUPAC name is 5-chloro-4-[methyl-[(1-methylpyrazol-4-yl)methyl]amino]-1H-pyrimidin-6-one.
| Compound Name | 5-chloro-4-[methyl-[(1-methylpyrazol-4-yl)methyl]amino]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136971007 |
| Molecular Formula | C10H12ClN5O |
| Molecular Weight | 253.69 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | 5-chloro-4-[methyl-[(1-methylpyrazol-4-yl)methyl]amino]-1H-pyrimidin-6-one |
| SMILES | CN(Cc1cnn(C)c1)c1nc[nH]c(=O)c1Cl |
| InChI | InChI=1S/C10H12ClN5O/c1-15(4-7-3-14-16(2)5-7)9-8(11)10(17)13-6-12-9/h3,5-6H,4H2,1-2H3,(H,12,13,17) |
| InChIKey | XNPMRWJQXZHAKS-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 66.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.69 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |