C7H8Cl2N2O3S — CID 136971739
5-chloro-4-(1-chloropropan-2-ylsulfonyl)-1H-pyrimidin-6-one (PubChem CID 136971739) has the molecular formula C7H8Cl2N2O3S and a molecular weight of 271.12 g/mol. Its IUPAC name is 5-chloro-4-(1-chloropropan-2-ylsulfonyl)-1H-pyrimidin-6-one.
| Compound Name | 5-chloro-4-(1-chloropropan-2-ylsulfonyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136971739 |
| Molecular Formula | C7H8Cl2N2O3S |
| Molecular Weight | 271.12 g/mol |
| Exact Mass | 269.96 |
| IUPAC Name | 5-chloro-4-(1-chloropropan-2-ylsulfonyl)-1H-pyrimidin-6-one |
| SMILES | CC(CCl)S(=O)(=O)c1nc[nH]c(=O)c1Cl |
| InChI | InChI=1S/C7H8Cl2N2O3S/c1-4(2-8)15(13,14)7-5(9)6(12)10-3-11-7/h3-4H,2H2,1H3,(H,10,11,12) |
| InChIKey | GGLFHDOHHKWPPX-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 79.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.12 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|