C7H8ClFN2O — CID 135627623
5-chloro-4-(2-fluoropropan-2-yl)-1H-pyrimidin-6-one (PubChem CID 135627623) has the molecular formula C7H8ClFN2O and a molecular weight of 190.60 g/mol. Its IUPAC name is 5-chloro-4-(2-fluoropropan-2-yl)-1H-pyrimidin-6-one.
| Compound Name | 5-chloro-4-(2-fluoropropan-2-yl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135627623 |
| Molecular Formula | C7H8ClFN2O |
| Molecular Weight | 190.60 g/mol |
| Exact Mass | 190.03 |
| IUPAC Name | 5-chloro-4-(2-fluoropropan-2-yl)-1H-pyrimidin-6-one |
| SMILES | CC(C)(F)c1nc[nH]c(=O)c1Cl |
| InChI | InChI=1S/C7H8ClFN2O/c1-7(2,9)5-4(8)6(12)11-3-10-5/h3H,1-2H3,(H,10,11,12) |
| InChIKey | MSQQLHIJSQDPPJ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.60 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |