C7H9ClIN3O — CID 136971785
4-[2-chloroethyl(methyl)amino]-5-iodo-1H-pyrimidin-6-one (PubChem CID 136971785) has the molecular formula C7H9ClIN3O and a molecular weight of 313.53 g/mol. Its IUPAC name is 4-[2-chloroethyl(methyl)amino]-5-iodo-1H-pyrimidin-6-one.
| Compound Name | 4-[2-chloroethyl(methyl)amino]-5-iodo-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136971785 |
| Molecular Formula | C7H9ClIN3O |
| Molecular Weight | 313.53 g/mol |
| Exact Mass | 312.95 |
| IUPAC Name | 4-[2-chloroethyl(methyl)amino]-5-iodo-1H-pyrimidin-6-one |
| SMILES | CN(CCCl)c1nc[nH]c(=O)c1I |
| InChI | InChI=1S/C7H9ClIN3O/c1-12(3-2-8)6-5(9)7(13)11-4-10-6/h4H,2-3H2,1H3,(H,10,11,13) |
| InChIKey | RWNBMTFKPKAWDO-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.53 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|