C8H12IN3O — CID 136957361
4-(diethylamino)-5-iodo-1H-pyrimidin-6-one (PubChem CID 136957361) has the molecular formula C8H12IN3O and a molecular weight of 293.11 g/mol. Its IUPAC name is 4-(diethylamino)-5-iodo-1H-pyrimidin-6-one.
| Compound Name | 4-(diethylamino)-5-iodo-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136957361 |
| Molecular Formula | C8H12IN3O |
| Molecular Weight | 293.11 g/mol |
| Exact Mass | 293.00 |
| IUPAC Name | 4-(diethylamino)-5-iodo-1H-pyrimidin-6-one |
| SMILES | CCN(CC)c1nc[nH]c(=O)c1I |
| InChI | InChI=1S/C8H12IN3O/c1-3-12(4-2)7-6(9)8(13)11-5-10-7/h5H,3-4H2,1-2H3,(H,10,11,13) |
| InChIKey | CUKJYQLFNFWFOV-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.11 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|