C9H13ClIN3O — CID 136971809
4-[2-chloroethyl(propan-2-yl)amino]-5-iodo-1H-pyrimidin-6-one (PubChem CID 136971809) has the molecular formula C9H13ClIN3O and a molecular weight of 341.58 g/mol. Its IUPAC name is 4-[2-chloroethyl(propan-2-yl)amino]-5-iodo-1H-pyrimidin-6-one.
| Compound Name | 4-[2-chloroethyl(propan-2-yl)amino]-5-iodo-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136971809 |
| Molecular Formula | C9H13ClIN3O |
| Molecular Weight | 341.58 g/mol |
| Exact Mass | 340.98 |
| IUPAC Name | 4-[2-chloroethyl(propan-2-yl)amino]-5-iodo-1H-pyrimidin-6-one |
| SMILES | CC(C)N(CCCl)c1nc[nH]c(=O)c1I |
| InChI | InChI=1S/C9H13ClIN3O/c1-6(2)14(4-3-10)8-7(11)9(15)13-5-12-8/h5-6H,3-4H2,1-2H3,(H,12,13,15) |
| InChIKey | YXYMXCGDLFCRPT-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.58 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|