C9H11BrClN3O2 — CID 136972039
4-[2-(bromomethyl)morpholin-4-yl]-5-chloro-1H-pyrimidin-6-one (PubChem CID 136972039) has the molecular formula C9H11BrClN3O2 and a molecular weight of 308.56 g/mol. Its IUPAC name is 4-[2-(bromomethyl)morpholin-4-yl]-5-chloro-1H-pyrimidin-6-one.
| Compound Name | 4-[2-(bromomethyl)morpholin-4-yl]-5-chloro-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136972039 |
| Molecular Formula | C9H11BrClN3O2 |
| Molecular Weight | 308.56 g/mol |
| Exact Mass | 306.97 |
| IUPAC Name | 4-[2-(bromomethyl)morpholin-4-yl]-5-chloro-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]cnc(N2CCOC(CBr)C2)c1Cl |
| InChI | InChI=1S/C9H11BrClN3O2/c10-3-6-4-14(1-2-16-6)8-7(11)9(15)13-5-12-8/h5-6H,1-4H2,(H,12,13,15) |
| InChIKey | BRTGROBHUGBIJH-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.56 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|