C11H15BrClN3O2 — CID 136972063
4-[4-(2-bromoethoxy)piperidin-1-yl]-5-chloro-1H-pyrimidin-6-one (PubChem CID 136972063) has the molecular formula C11H15BrClN3O2 and a molecular weight of 336.62 g/mol. Its IUPAC name is 4-[4-(2-bromoethoxy)piperidin-1-yl]-5-chloro-1H-pyrimidin-6-one.
| Compound Name | 4-[4-(2-bromoethoxy)piperidin-1-yl]-5-chloro-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136972063 |
| Molecular Formula | C11H15BrClN3O2 |
| Molecular Weight | 336.62 g/mol |
| Exact Mass | 335.00 |
| IUPAC Name | 4-[4-(2-bromoethoxy)piperidin-1-yl]-5-chloro-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]cnc(N2CCC(OCCBr)CC2)c1Cl |
| InChI | InChI=1S/C11H15BrClN3O2/c12-3-6-18-8-1-4-16(5-2-8)10-9(13)11(17)15-7-14-10/h7-8H,1-6H2,(H,14,15,17) |
| InChIKey | LFMFVCMHANSKAX-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.62 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|