C10H15N5OS — CID 136973223
2-[4-(6-oxo-1H-pyrimidin-4-yl)piperazin-1-yl]ethanethioamide (PubChem CID 136973223) has the molecular formula C10H15N5OS and a molecular weight of 253.33 g/mol. Its IUPAC name is 2-[4-(6-oxo-1H-pyrimidin-4-yl)piperazin-1-yl]ethanethioamide.
| Compound Name | 2-[4-(6-oxo-1H-pyrimidin-4-yl)piperazin-1-yl]ethanethioamide |
|---|---|
| PubChem CID | 136973223 |
| Molecular Formula | C10H15N5OS |
| Molecular Weight | 253.33 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | 2-[4-(6-oxo-1H-pyrimidin-4-yl)piperazin-1-yl]ethanethioamide |
| SMILES | NC(=S)CN1CCN(c2cc(=O)[nH]cn2)CC1 |
| InChI | InChI=1S/C10H15N5OS/c11-8(17)6-14-1-3-15(4-2-14)9-5-10(16)13-7-12-9/h5,7H,1-4,6H2,(H2,11,17)(H,12,13,16) |
| InChIKey | RXPWTORRHCVNFA-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 78.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.33 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|